Enter Chemical Equation:

Examples of Equations you can enter:
  • KMnO4 + HCl = KCl + MnCl2 + H2O + Cl2
  • KMnO4 + (HO2C)2= CO2 + H2O + KMn(OH)2
  • MnO4- + H2C2O4 + H+ = Mn++ + CO2 + H2O
  • Al + I2 = Al+++ + I-
  • H+Cr2O7--=Cr+H2O+e
  • H2SO4(aq) + V2O3(s) = V2(SO4)3 + H2O
  • Bi(NO3)3*5H2O+H2O2+RuCl3+NaOH=Bi2Ru2O7+NaNO3+NaCl+H2O

Click here to see an interactive Periodic Table of the Elements.

Recently Entered Equations:
Input EquationBalanced Equation
AlCl3(aq) + Ba(OH)2(aq) = Al(OH)3(s) + BaCl2(aq)2AlCl3(aq) + 3Ba(OH)2(aq) = 2Al(OH)3(s) + 3BaCl2(aq)
Al + HCl = AlCl3 + H22Al + 6HCl = 2AlCl3 + 3H2
Al2(CO3)3 = Al2O3 + CO2 Al2(CO3)3 = Al2O3 + 3CO2
Al2O3 + H2SO4 = Al2(SO4)3 + H2OAl2O3 + 3H2SO4 = Al2(SO4)3 + 3H2O
Al2O3+6HNO3=2Al(NO3)3+3H2OAl2O3 + 6HNO3 = 2Al(NO3)3 + 3H2O
Al2O3+6HNO3=2Al(NO3)3+3H2OAl2O3 + 6HNO3 = 2Al(NO3)3 + 3H2O
Al2O3+6HNO3=2Al(NO3)3+3H2OAl2O3 + 6HNO3 = 2Al(NO3)3 + 3H2O
Al + 3CuCl = AlCl3 + 3CuAl + 3CuCl = AlCl3 + 3Cu
AgNO3 + AlCl3 =AgCl + Al(NO3)33AgNO3 + AlCl3 = 3AgCl + Al(NO3)3
Ag+2HCl=AgCl+H22Ag + 2HCl = 2AgCl + H2
Ag+2HCl=AgCl+H22Ag + 2HCl = 2AgCl + H2
Al2 (CO3)3 = Al2O3 + CO2 Al2(CO3)3 = Al2O3 + 3CO2
Al2 (SO4)3 +K OH = Al (OH)3 +K2SO4Al2(SO4)3 + 6KOH = 2Al(OH)3 + 3K2SO4
Al(OH)3 + HMnO4 = Al(MnO4)3 + H2OAl(OH)3 + 3HMnO4 = Al(MnO4)3 + 3H2O
Al + H2SO4 = Al2(SO4)3 + H2 2Al + 3H2SO4 = Al2(SO4)3 + 3H2
Al+CuSO4=Al2 (SO4)3+Cu2Al + 3CuSO4 = Al2(SO4)3 + 3Cu
Al+CuSO4=Al2 (SO4)3+Cu2Al + 3CuSO4 = Al2(SO4)3 + 3Cu
Al2(CO3)3 = Al2O3 + CO2Al2(CO3)3 = Al2O3 + 3CO2
Al2O3=Al+O22Al2O3 = 4Al + 3O2
AgNO3 + AlCl3 = AgCl + Al(NO3)33AgNO3 + AlCl3 = 3AgCl + Al(NO3)3
AgNO3 + AlCl3 = AgCl + Al(NO3)33AgNO3 + AlCl3 = 3AgCl + Al(NO3)3
Al(s) + N2(g) = AlN(s)2Al(s) + N2(g) = 2AlN(s)
Al2(SO4)3+NaCl=Na2(SO4)+AlCl3Al2(SO4)3 + 6NaCl = 3Na2(SO4) + 2AlCl3
AgNO3+Cu=Cu(NO3)2+Ag2AgNO3 + Cu = Cu(NO3)2 + 2Ag
AgNO3 + Li = LiNO3 + AgAgNO3 + Li = LiNO3 + Ag
AIBr3 + K = KBr + AIAIBr3 + 3K = 3KBr + AI
Al+O2=Al2O34Al + 3O2 = 2Al2O3
Al+Fe2O3= Al2O3+Fe2Al + Fe2O3 = Al2O3 + 2Fe
Al + HCl = AlCl3 + H22Al + 6HCl = 2AlCl3 + 3H2
Ag2O +NO +NaOH = Ag + NaNO3 + H2O3Ag2O + 2NO + 2NaOH = 6Ag + 2NaNO3 + H2O
Al+S=Al2S32Al + 3S = Al2S3
Ag2SO4 + NaCl = Na2SO4 + AgClAg2SO4 + 2NaCl = Na2SO4 + 2AgCl
AgNO3+H2S=Ag2S+HNO32AgNO3 + H2S = Ag2S + 2HNO3
Al+CuCl2=AlCl3+Cu2Al + 3CuCl2 = 2AlCl3 + 3Cu
AuBr3=Au+Br22AuBr3 = 2Au + 3Br2
Ag2O=Ag+O22Ag2O = 4Ag + O2
Ag2O=Ag+O22Ag2O = 4Ag + O2
Ag+KCN+O2+H2O=KAg(CN)2+KOH4Ag + 8KCN + O2 + 2H2O = 4KAg(CN)2 + 4KOH
Al(NO3)3 + NaOH = Al(OH)3 + NaNO3Al(NO3)3 + 3NaOH = Al(OH)3 + 3NaNO3
AlCl3=Al+Cl22AlCl3 = 2Al + 3Cl2
AI+NiBr2=AIBr3+Ni2AI + 3NiBr2 = 2AIBr3 + 3Ni
AlCl3(aq) + Ba(OH)2(aq) = Al(OH)3(s) + BaCl2(aq)2AlCl3(aq) + 3Ba(OH)2(aq) = 2Al(OH)3(s) + 3BaCl2(aq)
AgNO3 + NaCl = AgCl + NaNO3AgNO3 + NaCl = AgCl + NaNO3
Al+FeSO4=Al2(SO4)3+Fe2Al + 3FeSO4 = Al2(SO4)3 + 3Fe
Ag+S8=Ag2S16Ag + S8 = 8Ag2S
Ag+Cl2=AgCl2Ag + Cl2 = 2AgCl
Al(NO3)3 +Na2S = Al2S3+ NaNO32Al(NO3)3 + 3Na2S = Al2S3 + 6NaNO3
Al2(SO4)3 + Ca(OH)2 = Al(OH)3 + Ca2(SO4)22Al2(SO4)3 + 6Ca(OH)2 = 4Al(OH)3 + 3Ca2(SO4)2
Al2O3 + HCl = AlCl3 + H(OH)Al2O3 + 6HCl = 2AlCl3 + 3H(OH)
AgNO3 + Fe = Fe(NO3)2 + Ag 2AgNO3 + Fe = Fe(NO3)2 + 2Ag
Al+Fe2O3=Fe+Al2O32Al + Fe2O3 = 2Fe + Al2O3
Al +HCl =AlCl3 +H22Al + 6HCl = 2AlCl3 + 3H2
Al + HCl = AlCl3 + H22Al + 6HCl = 2AlCl3 + 3H2
Al4C3+H2O=CH4+Al(OH)3Al4C3 + 12H2O = 3CH4 + 4Al(OH)3
Al4C3+H2O=CH4+Al(OH)3Al4C3 + 12H2O = 3CH4 + 4Al(OH)3
Al4C3+H2O=CH4+Al(OH)3Al4C3 + 12H2O = 3CH4 + 4Al(OH)3
Al4C3+H2O=CH4+Al(OH)3Al4C3 + 12H2O = 3CH4 + 4Al(OH)3
Al4C3+H2O=CH4+Al(OH)3Al4C3 + 12H2O = 3CH4 + 4Al(OH)3
Al2(CO3)3 = Al2O3 + CO2Al2(CO3)3 = Al2O3 + 3CO2
Al2O3+CO=Al+CO2Al2O3 + 3CO = 2Al + 3CO2
Al + F2 = AlF32Al + 3F2 = 2AlF3
Al2O3 = Al + O22Al2O3 = 4Al + 3O2
Al2O3 = Al + O22Al2O3 = 4Al + 3O2
AlBr3 + LiOH = H2O + Al(OH)3 +LiBrAlBr3 + 3LiOH = 0H2O + Al(OH)3 + 3LiBr
Al(s)+FeSO4(aq)=Al2(SO4)3(aq)+Fe(s)2Al(s) + 3FeSO4(aq) = Al2(SO4)3(aq) + 3Fe(s)
Al+Fe3O4=Al2O3+Fe8Al + 3Fe3O4 = 4Al2O3 + 9Fe
Al+H2O=AlO2 + H2Al + 2H2O = AlO2 + 2H2
Al2(SO4)3 + Ca(OH)2 = Al(OH)3 + CaSO4Al2(SO4)3 + 3Ca(OH)2 = 2Al(OH)3 + 3CaSO4
Al + NaOH + H2O = NaAl(OH)4 + H22Al + 2NaOH + 6H2O = 2NaAl(OH)4 + 3H2
Al2(CO3)3 = Al2O3 + CO2Al2(CO3)3 = Al2O3 + 3CO2
AS2O3+H2S=AS2S3+H2OAS2O3 + 3H2S = AS2S3 + 3H2O
Al2(SO4)3+NaOH = Al(OH)3+Na2SO4Al2(SO4)3 + 6NaOH = 2Al(OH)3 + 3Na2SO4
Al+CuCl2=AlCl3+Cu2Al + 3CuCl2 = 2AlCl3 + 3Cu
Al+3Br2=2AlBr32Al + 3Br2 = 2AlBr3
Al+Br2=AlBr32Al + 3Br2 = 2AlBr3
Al + O2 = Al2O34Al + 3O2 = 2Al2O3
Al + O2 = Al2O34Al + 3O2 = 2Al2O3
AgNO3+AlCl3=AgCl3+AlNO3AgNO3 + AlCl3 = AgCl3 + AlNO3
Al2 O3 + H 2O =Al(OH)3Al2O3 + 3H2O = 2Al(OH)3
Al +N2 = AlN2Al + N2 = 2AlN
Al +O 2 = Al2 O22Al + O2 = Al2O2
Al2(C2O4)3 = Al2O3 +CO + CO2Al2(C2O4)3 = Al2O3 + 3CO + 3CO2
Al + I2 = Al+++ + I-2Al + 3I2 = 2Al+++ + 6I-
Al+H2O= Al(OH)3+H22Al + 6H2O = 2Al(OH)3 + 3H2
Al2(SO4)3*18H2O + K2SO4 + H2O = KAl(SO4)2*12H2OAl2(SO4)3*18H2O + K2SO4 + 6H2O = 2KAl(SO4)2*12H2O
AgNO2 + BaSO4 = Ag2(SO4)2 + NO2Ba2AgNO2 + 2BaSO4 = Ag2(SO4)2 + 2NO2Ba
AgNO2 + BaSO4 = Ag2(SO4)2 + NO2Ba2AgNO2 + 2BaSO4 = Ag2(SO4)2 + 2NO2Ba
AgNO2 + BaSO4 = Ag2(SO4)2 + NO2Ba2AgNO2 + 2BaSO4 = Ag2(SO4)2 + 2NO2Ba
AgNO2 + BaSO4 = Ag2(SO4)2 + NO2Ba2AgNO2 + 2BaSO4 = Ag2(SO4)2 + 2NO2Ba
AgNO2 + BaSO4 = Ag2(SO4)2 + NO2Ba2AgNO2 + 2BaSO4 = Ag2(SO4)2 + 2NO2Ba
AgNO2 + BaSO4 = Ag2(SO4)2 + NO2Ba2AgNO2 + 2BaSO4 = Ag2(SO4)2 + 2NO2Ba
AgNO2 + BaSO4 = Ag2(SO4)2 + NO2Ba2AgNO2 + 2BaSO4 = Ag2(SO4)2 + 2NO2Ba
AgNO2 + BaSO4 = Ag2(SO4)2 + NO2Ba2AgNO2 + 2BaSO4 = Ag2(SO4)2 + 2NO2Ba
AgNO2 + BaSO4 = Ag2(SO4)2 + NO2Ba2AgNO2 + 2BaSO4 = Ag2(SO4)2 + 2NO2Ba
Ag + CuSO4 = Cu2 + AgSO42Ag + 2CuSO4 = Cu2 + 2AgSO4
Ag + CuSO4 = SO4Ag + CuAg + CuSO4 = SO4Ag + Cu
Ag2S + H2 = Ag + H2SAg2S + H2 = 2Ag + H2S
Al(s) + H2SO4(aq) = Al2(SO4)3(aq) + H2(g)2Al(s) + 3H2SO4(aq) = Al2(SO4)3(aq) + 3H2(g)
Al+Cl2=AlCl32Al + 3Cl2 = 2AlCl3
AgNO3+H2S=Ag2S+HNO32AgNO3 + H2S = Ag2S + 2HNO3
Al +S8 = Al2S316Al + 3S8 = 8Al2S3
Al + HO- +6H2O = Al(OH)4- + 3H22Al + 2HO- + 6H2O = 2Al(OH)4- + 3H2
Al2(SO4)3+Ca(OH)2=Al(OH)3+CaSO4Al2(SO4)3 + 3Ca(OH)2 = 2Al(OH)3 + 3CaSO4
Al2(SO4)3+Ca(OH)2=Al(OH)3+(CaSO4)3Al2(SO4)3 + 3Ca(OH)2 = 2Al(OH)3 + (CaSO4)3
AlCl3(aq) + Ba(OH)2(aq) = Al(OH)3(s) + BaCl2(aq)2AlCl3(aq) + 3Ba(OH)2(aq) = 2Al(OH)3(s) + 3BaCl2(aq)
AlL3+HgCl2=AlCl3+HgL22AlL3 + 3HgCl2 = 2AlCl3 + 3HgL2
AgNO3+K3PO4=Ag3PO4+KNO33AgNO3 + K3PO4 = Ag3PO4 + 3KNO3
Al+Cl2=AlCl32Al + 3Cl2 = 2AlCl3
AlN + 3H2O = Al(OH)3 + NH3AlN + 3H2O = Al(OH)3 + NH3
AlN +H2O = Al(OH)3 +NH3AlN + 3H2O = Al(OH)3 + NH3
AlCl3(aq) + Ba(OH)2(aq) = Al(OH)3(s) + BaCl2(aq)2AlCl3(aq) + 3Ba(OH)2(aq) = 2Al(OH)3(s) + 3BaCl2(aq)
AgNO3+Pb=Pb(NO3)2+Ag2AgNO3 + Pb = Pb(NO3)2 + 2Ag
Al+O2=Al2O34Al + 3O2 = 2Al2O3
Au2S3+H2=Au+H2SAu2S3 + 3H2 = 2Au + 3H2S
As+NaOH=Na3AsO3+H22As + 6NaOH = 2Na3AsO3 + 3H2
Al+Cu(SO4)= Cu+ Al(SO4)3Al + 3Cu(SO4) = 3Cu + Al(SO4)3
AlF3 = Al+F22AlF3 = 2Al + 3F2
Al+NaOH+H2O=NaAlO2+H22Al + 2NaOH + 2H2O = 2NaAlO2 + 3H2
Al2S3=Al+S88Al2S3 = 16Al + 3S8
AgF+CaCl2=AgCl+CaF22AgF + CaCl2 = 2AgCl + CaF2
Al2(SO4)3+BaCl2=BaSO4+AlCl3Al2(SO4)3 + 3BaCl2 = 3BaSO4 + 2AlCl3
AlCl3+ Na2SO4= Al2(SO4)3+NaCl2AlCl3 + 3Na2SO4 = Al2(SO4)3 + 6NaCl
Al + NaOH + H2O= NaAlO2 +H22Al + 2NaOH + 2H2O = 2NaAlO2 + 3H2
Al2(SO4)3 + NaOH=Na2SO4 + NaAlO2+ H2OAl2(SO4)3 + 8NaOH = 3Na2SO4 + 2NaAlO2 + 4H2O
Al + SnCl2 = AlCl2 + SnAl + SnCl2 = AlCl2 + Sn
Al+H2SO4=Al2(SO4)3+H22Al + 3H2SO4 = Al2(SO4)3 + 3H2
Al(s) + 3AgNO3(aq) = Al(NO3)3(aq) + 3Ag(s)Al(s) + 3AgNO3(aq) = Al(NO3)3(aq) + 3Ag(s)
Al+H2SO4=Al2(SO4)3+H22Al + 3H2SO4 = Al2(SO4)3 + 3H2
As2O3+C2=As+CO24As2O3 + 3C2 = 8As + 6CO2
Al2O3+H2O=Al(OH)3Al2O3 + 3H2O = 2Al(OH)3
Al + I2 = Al+++ + I-2Al + 3I2 = 2Al+++ + 6I-
AgZn + C = Ag + Zn4C24AgZn + 2C = 4Ag + Zn4C2
AgZn + C = Ag4C +Zn4AgZn + C = Ag4C + 4Zn
Al+H2SO4=Al2(SO4)3+H22Al + 3H2SO4 = Al2(SO4)3 + 3H2
AlO+Li(OH)=Al(OH)+LiOAlO + Li(OH) = Al(OH) + LiO
Al(s)+H2SO4(aq)=H2(g)+Al2(SO4)3(aq)2Al(s) + 3H2SO4(aq) = 3H2(g) + Al2(SO4)3(aq)
AlO+LiOH=AlOH+LiOAlO + LiOH = AlOH + LiO
As2O3+KIO4+KHO=K3AsO4+KIO3+H2OAs2O3 + 2KIO4 + 6KHO = 2K3AsO4 + 2KIO3 + 3H2O
AgNO3(aq)+NaCl(aq)=AgCl(s)+NaNO3(aq)AgNO3(aq) + NaCl(aq) = AgCl(s) + NaNO3(aq)
Al2O3+CO=Al+CO2Al2O3 + 3CO = 2Al + 3CO2
Al2(CO3)3 + ZnCl2 = ZnCO3 + AlCl3Al2(CO3)3 + 3ZnCl2 = 3ZnCO3 + 2AlCl3
Ag+ +I-=AgI(s)Ag+ + I- = AgI(s)
AlCl3(aq) + Ba(OH)2(aq) =Al(OH)3(s) + BaCl2(aq)2AlCl3(aq) + 3Ba(OH)2(aq) = 2Al(OH)3(s) + 3BaCl2(aq)
Al+CuCl2=AlCl3+Cu2Al + 3CuCl2 = 2AlCl3 + 3Cu
Al+S8=Al2S316Al + 3S8 = 8Al2S3
Al(OH)3+K2CO3=Al2(CO3)3+KOH2Al(OH)3 + 3K2CO3 = Al2(CO3)3 + 6KOH
Ag2O=Ag+O22Ag2O = 4Ag + O2
Al2(CO3)3+HNO3=Al(NO3)3+CO2+H2OAl2(CO3)3 + 6HNO3 = 2Al(NO3)3 + 3CO2 + 3H2O
Al(s)+Fe2O3=AlO3+Fe(l)Al(s) + Fe2O3 = AlO3 + 2Fe(l)
Al(OH)3+ H2SO4 = Al2(SO4)3 +H2O2Al(OH)3 + 3H2SO4 = Al2(SO4)3 + 6H2O
AgNO3 + MgBr2 = AgBr + Mg(NO3)22AgNO3 + MgBr2 = 2AgBr + Mg(NO3)2
Al+HCl=AlCl+H22Al + 2HCl = 2AlCl + H2
Al + CuCl2=Cu+AlCl32Al + 3CuCl2 = 3Cu + 2AlCl3
AgNO3+BaCl2=AgCl+Ba(NO3)22AgNO3 + BaCl2 = 2AgCl + Ba(NO3)2
Al+O2+H=Al (OH)32Al + 3O2 + 6H = 2Al(OH)3
Al2+O2+H=Al (OH)3Al2 + 3O2 + 6H = 2Al(OH)3
AgNO3+H2SO4=Ag2SO4+HNO32AgNO3 + H2SO4 = Ag2SO4 + 2HNO3
Al(OH)3+HCl=AlCl3+H2OAl(OH)3 + 3HCl = AlCl3 + 3H2O
Al + HNO3 = Al(NO3)2 + N2O + H2O4Al + 10HNO3 = 4Al(NO3)2 + N2O + 5H2O
AlCl3 + Ba(OH)2 = Al(OH)3 + BaCl22AlCl3 + 3Ba(OH)2 = 2Al(OH)3 + 3BaCl2
Al + HCl = H2 + AlCl32Al + 6HCl = 3H2 + 2AlCl3
AlBr3 + K2SO4 = KBr + Al2(SO4)32AlBr3 + 3K2SO4 = 6KBr + Al2(SO4)3
AgNO3 + Cu = Cu(NO3)2 + Ag2AgNO3 + Cu = Cu(NO3)2 + 2Ag
AgNO3 + AlCl3 =AgCl + Al(NO3)33AgNO3 + AlCl3 = 3AgCl + Al(NO3)3
AlCl3(aq) + Ba(OH)2(aq) =Al(OH)3(s) + BaCl2(aq) 2AlCl3(aq) + 3Ba(OH)2(aq) = 2Al(OH)3(s) + 3BaCl2(aq)
AgCl+NH4OH=Ag(NH3)2Cl+H2OAgCl + 2NH4OH = Ag(NH3)2Cl + 2H2O
Al+H2SO4=Al2(SO4)3+H2O+SO22Al + 6H2SO4 = Al2(SO4)3 + 6H2O + 3SO2
Al+H2SO4=Al2(SO4)3+H22Al + 3H2SO4 = Al2(SO4)3 + 3H2
Al+NaOH+H2O=NaAlO2+H22Al + 2NaOH + 2H2O = 2NaAlO2 + 3H2
Al(s)+N2(g)=AlN(s)2Al(s) + N2(g) = 2AlN(s)
AlCl3+NH4OH=Al(OH)3+NH4ClAlCl3 + 3NH4OH = Al(OH)3 + 3NH4Cl
AgNO3 + CuCl2 = AgCl + Cu(NO3)22AgNO3 + CuCl2 = 2AgCl + Cu(NO3)2
Al2(SO4)3 + KOH = Al(OH)3 + K2SO4Al2(SO4)3 + 6KOH = 2Al(OH)3 + 3K2SO4
Al(OH)3 + NaOH = NaAlO2 + H2OAl(OH)3 + NaOH = NaAlO2 + 2H2O
Al(NO3)3 + NaOH = Al(OH)3 + NaNO3Al(NO3)3 + 3NaOH = Al(OH)3 + 3NaNO3
Al2(SO4)3+Ca(OH)2=Al(OH)3+CaSO4Al2(SO4)3 + 3Ca(OH)2 = 2Al(OH)3 + 3CaSO4
AlCl3(aq) + Ba(OH)2(aq) = Al(OH)3(s) + BaCl2(aq)2AlCl3(aq) + 3Ba(OH)2(aq) = 2Al(OH)3(s) + 3BaCl2(aq)
Al2(SO4)3+2Ca(OH)2=Al(OH)3+2CaSO4Al2(SO4)3 + 3Ca(OH)2 = 2Al(OH)3 + 3CaSO4
Al2O3=Al+O22Al2O3 = 4Al + 3O2
Au + HCl = AuCl2 + H2Au + 2HCl = AuCl2 + H2
AlCl3(aq) + Ba(OH)2(aq) = Al(OH)3(s) + BaCl2(aq)2AlCl3(aq) + 3Ba(OH)2(aq) = 2Al(OH)3(s) + 3BaCl2(aq)
AlCl3(aq) + Ba(OH)2(aq) = Al(OH)3(s) + BaCl2(aq)2AlCl3(aq) + 3Ba(OH)2(aq) = 2Al(OH)3(s) + 3BaCl2(aq)
AlCl3(aq) +Ba(OH)2(aq) =Al(OH)3(s) +BaCl2(aq)2AlCl3(aq) + 3Ba(OH)2(aq) = 2Al(OH)3(s) + 3BaCl2(aq)
Al + O2=AlO2Al + O2 = AlO2
AgNO3 + AlCl3 = AgCl + Al(NO3)33AgNO3 + AlCl3 = 3AgCl + Al(NO3)3
Al+N2=AlN2Al + N2 = 2AlN
Al(s) + NaOH(aq) + H2O(l) = NaAlO2(aq) + H2(g)2Al(s) + 2NaOH(aq) + 2H2O(l) = 2NaAlO2(aq) + 3H2(g)
Al(s) + NaOH(aq) + H2O(l) = NaAlO2(aq) + H2(g)2Al(s) + 2NaOH(aq) + 2H2O(l) = 2NaAlO2(aq) + 3H2(g)
Al+O2=Al2O34Al + 3O2 = 2Al2O3
AgNO3 + CuCl2 = AgCl + Cu(NO3)22AgNO3 + CuCl2 = 2AgCl + Cu(NO3)2
Al + H2SO4 = Al2(SO4)3 + H22Al + 3H2SO4 = Al2(SO4)3 + 3H2
As2O3+C=CO2+As2As2O3 + 3C = 3CO2 + 4As
Al(NO3)3+Na2S=Al2S3+NaNO32Al(NO3)3 + 3Na2S = Al2S3 + 6NaNO3
Al+O2=Al2O34Al + 3O2 = 2Al2O3
Al2S3+BaH2=AlH3+BaSAl2S3 + 3BaH2 = 2AlH3 + 3BaS
Al + CuO = Al2O3 + Cu2Al + 3CuO = Al2O3 + 3Cu
AlBr3+K2SO4=KBr+Al2(SO4)32AlBr3 + 3K2SO4 = 6KBr + Al2(SO4)3
AlCl3 + Fe = FeCl3 + AlAlCl3 + Fe = FeCl3 + Al
Al2O3 + HNO3 = Al(NO3)3 + H2OAl2O3 + 6HNO3 = 2Al(NO3)3 + 3H2O
Al+HCl=AlCl3+H22Al + 6HCl = 2AlCl3 + 3H2
Ag + HNO3 = AgNO3 + NO + 2H2O3Ag + 4HNO3 = 3AgNO3 + NO + 2H2O
AlCl3 + Ba(OH)2 = Al(OH)3 + BaCl22AlCl3 + 3Ba(OH)2 = 2Al(OH)3 + 3BaCl2
AlCl3(aq) + Ba(OH)2(aq) = Al(OH)3(s) + BaCl2(aq)2AlCl3(aq) + 3Ba(OH)2(aq) = 2Al(OH)3(s) + 3BaCl2(aq)
AlCl3 + Ba(OH)2 = Al(OH)3 + BaCl22AlCl3 + 3Ba(OH)2 = 2Al(OH)3 + 3BaCl2
AlCl3 + Ba(OH)2 = Al(OH)3 + BaCl22AlCl3 + 3Ba(OH)2 = 2Al(OH)3 + 3BaCl2
AgClO3 = AgCl + O22AgClO3 = 2AgCl + 3O2
Al + O2 = Al2O34Al + 3O2 = 2Al2O3
Ag2 O + Na 2 HPO3 + Na OH= Ag + Na3 PO4 + H2OAg2O + Na2HPO3 + NaOH = 2Ag + Na3PO4 + H2O
AlCl3 + AgNO3 = AgCl + Al(NO3)3AlCl3 + 3AgNO3 = 3AgCl + Al(NO3)3
Al + FeO3 = Al2O3 + Fe2Al + FeO3 = Al2O3 + Fe
AlPO4 + NH4Cl = N(AlO4) + P(H4Cl)AlPO4 + NH4Cl = N(AlO4) + P(H4Cl)
AlPO4 + NH4Cl = N(AlO4) + P(H4Cl)AlPO4 + NH4Cl = N(AlO4) + P(H4Cl)
AlPO4 + NH4Cl = N(AlO4) + P(H4Cl)AlPO4 + NH4Cl = N(AlO4) + P(H4Cl)
As2S3 + HNO3 + H2O = H2SO4 + H3AsO4 + NO3As2S3 + 28HNO3 + 4H2O = 9H2SO4 + 6H3AsO4 + 28NO
AlCl3(aq) + Ba(OH)2(aq) = Al(OH)3(s) + BaCl2(aq)2AlCl3(aq) + 3Ba(OH)2(aq) = 2Al(OH)3(s) + 3BaCl2(aq)
Ag + H2 S = Ag2S + H22Ag + H2S = Ag2S + H2
Al(s) + 3AgNO3(aq) = Al(NO3)3 (aq) + 3Ag (s)Al(s) + 3AgNO3(aq) = Al(NO3)3(aq) + 3Ag(s)
Al + H2SO4 = Al2(SO4)3 + H22Al + 3H2SO4 = Al2(SO4)3 + 3H2
Al + NaOH + H2O = NaAl(OH)4 + H22Al + 2NaOH + 6H2O = 2NaAl(OH)4 + 3H2
Al2S3 + H2O = Al(OH)3 + H2SAl2S3 + 6H2O = 2Al(OH)3 + 3H2S
Al+Cu(NO3)2=Cu+Al(NO3)32Al + 3Cu(NO3)2 = 3Cu + 2Al(NO3)3
Al+H2SO4=Al2(SO4)3+H22Al + 3H2SO4 = Al2(SO4)3 + 3H2
AgNO3 + MgCl2 = AgCl + Mg(NO3)22AgNO3 + MgCl2 = 2AgCl + Mg(NO3)2
Al(NO3)3 + CaBr2 = AlBr2 + Ca(NO3)3Al(NO3)3 + CaBr2 = AlBr2 + Ca(NO3)3
AlCl3 + H2O = H3AlO3 + HAlCl44AlCl3 + 3H2O = H3AlO3 + 3HAlCl4
AgC2H3O2= Ag + C2 + H2 + O22AgC2H3O2 = 2Ag + 2C2 + 3H2 + 2O2
Al + I = AlIAl + I = AlI
Al + I = AlIAl + I = AlI
Al2(SO4)3+Ba(NO3)2=Al(NO3)3+BaSO4Al2(SO4)3 + 3Ba(NO3)2 = 2Al(NO3)3 + 3BaSO4
Al2O3+HCl=AlCl3+H2OAl2O3 + 6HCl = 2AlCl3 + 3H2O
Ag2SO4 + (NH4)2CO3 = Ag2CO3 + (NH4)2SO4Ag2SO4 + (NH4)2CO3 = Ag2CO3 + (NH4)2SO4
Ag2SO4 + K2CrO4 = K2SO4 + Ag2CrO4Ag2SO4 + K2CrO4 = K2SO4 + Ag2CrO4
AgNO3+CaCl2=AgCl+Ca(NO3)22AgNO3 + CaCl2 = 2AgCl + Ca(NO3)2
AgNO3+CaCl2=AgCl+Ca(NO3)22AgNO3 + CaCl2 = 2AgCl + Ca(NO3)2
AgNO3+CaCl2=AgCl+Ca(NO3)22AgNO3 + CaCl2 = 2AgCl + Ca(NO3)2
AlCl3+NaOH= Al(OH)3+NaClAlCl3 + 3NaOH = Al(OH)3 + 3NaCl
Au2O3=Au+O22Au2O3 = 4Au + 3O2
Al2(SO4)3+Ca(OH)2=Al(OH)3+CaSO4Al2(SO4)3 + 3Ca(OH)2 = 2Al(OH)3 + 3CaSO4
Al+Cl2=AlCl32Al + 3Cl2 = 2AlCl3
AgNO3 + NaCl = AgCl + NaNO3AgNO3 + NaCl = AgCl + NaNO3
AgNO3+Ga=Ag+Ga(NO3)33AgNO3 + Ga = 3Ag + Ga(NO3)3
AuCl3 + KI = AuCl + KCl +I2AuCl3 + 2KI = AuCl + 2KCl + I2
Al (C2H3O2)2(aq) + (NH4)2PO4 (aq) = AlPO4(s) + 2 NH4C2H3O2 (aq) Al(C2H3O2)2(aq) + (NH4)2PO4(aq) = AlPO4(s) + 2NH4C2H3O2(aq)
Al(s)+FeSO4(aq)=Al2(SO4)3(aq)+Fe(s)2Al(s) + 3FeSO4(aq) = Al2(SO4)3(aq) + 3Fe(s)
Al(OH)3 + H2SO4 = Al2(SO4)3 + H2O2Al(OH)3 + 3H2SO4 = Al2(SO4)3 + 6H2O
As2S5 + NHO3 + H2O = H2SO4 + H3AsO4 + NO3As2S5 + 40NHO3 + 4H2O = 15H2SO4 + 6H3AsO4 + 40NO
Al(OH)3+H4SiO4=Al4(SiO4)3+H2O4Al(OH)3 + 3H4SiO4 = Al4(SiO4)3 + 12H2O
Al + H2O=AlO2-+ H2 + H+2Al + 4H2O = 2AlO2- + 3H2 + 2H+
Al2(CO3)3=Al2O3+CO2Al2(CO3)3 = Al2O3 + 3CO2
Al(s)+S(s)=Al2S3(s)2Al(s) + 3S(s) = Al2S3(s)
Au2O3=Au+O22Au2O3 = 4Au + 3O2
Al + Br2 = AlBr32Al + 3Br2 = 2AlBr3
As2S3 + 9O2 = 2As2O3 + SO22As2S3 + 9O2 = 2As2O3 + 6SO2
AlCl3 + 2SO4 = Al3(SO4)3 + Cl3AlCl3 + 3SO4 = Al3(SO4)3 + 9Cl
AlCl3 + Fe = FeCl3 + AlAlCl3 + Fe = FeCl3 + Al
Au2S3 + H2 = 2Au+ 3H2SAu2S3 + 3H2 = 2Au + 3H2S
Au2S3 + 3H2 = 2Au+ 3H2SAu2S3 + 3H2 = 2Au + 3H2S
Al2(SO4)3+Ca3(PO4)2=AlPO4+CaSO4Al2(SO4)3 + Ca3(PO4)2 = 2AlPO4 + 3CaSO4
Al + HCl = AlCl3 + H22Al + 6HCl = 2AlCl3 + 3H2
Al(s) + N2(g) = AlN(s)2Al(s) + N2(g) = 2AlN(s)
Au2S3+H2=Au+H2SAu2S3 + 3H2 = 2Au + 3H2S
Ag2S+KCN=KAg(CN)2+K2SAg2S + 4KCN = 2KAg(CN)2 + K2S
Al4C3+H2O=CH4+Al(OH)3Al4C3 + 12H2O = 3CH4 + 4Al(OH)3
Ag + CuSO4 = Cu +Ag(SO4)2Ag + 2CuSO4 = 2Cu + Ag(SO4)2
Ag + CuSO4 = Cu +Ag(SO4)Ag + CuSO4 = Cu + Ag(SO4)
Al+HCl=AlCl3+H22Al + 6HCl = 2AlCl3 + 3H2
Al3+H=AlH3Al3 + 9H = 3AlH3
Al2O3+ H2O=Al(OH)3Al2O3 + 3H2O = 2Al(OH)3
AL + N2 = ALN2AL + N2 = 2ALN
Al2O3 + HCl = AlCl3 + 3H2OAl2O3 + 6HCl = 2AlCl3 + 3H2O
As2S5+HNO3=H3AsO4+NO2+H2O+H2SO4As2S5 + 40HNO3 = 2H3AsO4 + 40NO2 + 12H2O + 5H2SO4
As2S5+HNO3=H3AsO4+NO2+H2O+H2SO4As2S5 + 40HNO3 = 2H3AsO4 + 40NO2 + 12H2O + 5H2SO4
As2S5+HNO3=H3AsO4+NO2+H2O+H2SO4As2S5 + 40HNO3 = 2H3AsO4 + 40NO2 + 12H2O + 5H2SO4
Al + O2 = Al2O34Al + 3O2 = 2Al2O3
Al + H2SO4 = Al2(SO4)3 + H22Al + 3H2SO4 = Al2(SO4)3 + 3H2
Al + H2O = Al(OH)3 + H22Al + 6H2O = 2Al(OH)3 + 3H2
AlCl3(aq) + Ba(OH)2(aq) = Al(OH)3(s) + BaCl2(aq)2AlCl3(aq) + 3Ba(OH)2(aq) = 2Al(OH)3(s) + 3BaCl2(aq)
Al+Fe3N2=AlN+Fe2Al + Fe3N2 = 2AlN + 3Fe
Al (s) + H2O(l)= Al(OH)3(s) + H22Al(s) + 6H2O(l) = 2Al(OH)3(s) + 3H2
Al+CuCl2=AlCl3+Cu2Al + 3CuCl2 = 2AlCl3 + 3Cu
AlCl3(aq) + Ba(OH)2(aq) = Al(OH)3(s) + BaCl2(aq)2AlCl3(aq) + 3Ba(OH)2(aq) = 2Al(OH)3(s) + 3BaCl2(aq)
AlCl3 + Ba(OH)2 = Al(OH)3 + BaCl22AlCl3 + 3Ba(OH)2 = 2Al(OH)3 + 3BaCl2
AlBr3 + 3LiOH = Al(OH)3 +LiBrAlBr3 + 3LiOH = Al(OH)3 + 3LiBr
AlCl3(aq) +Ba(OH)2(aq) = Al(OH)3(s) + BaCl2(aq)2AlCl3(aq) + 3Ba(OH)2(aq) = 2Al(OH)3(s) + 3BaCl2(aq)
AsO4-3 + Zn + H+1 = Zn+2 + H2O + AsH3AsO4-3 + 4Zn + 11H+1 = 4Zn+2 + 4H2O + AsH3
AlBr3 + LiOH = Al(OH)3 +LiBrAlBr3 + 3LiOH = Al(OH)3 + 3LiBr
Al + H2SO4 = Al2O3 + H2O + SO22Al + 3H2SO4 = Al2O3 + 3H2O + 3SO2
Al2O3 + C = CO + AlAl2O3 + 3C = 3CO + 2Al
AlCl3(aq) + Ba(OH)2(aq) = Al(OH)3(s) + BaCl2(aq)2AlCl3(aq) + 3Ba(OH)2(aq) = 2Al(OH)3(s) + 3BaCl2(aq)
Ag2O=Ag+O22Ag2O = 4Ag + O2
As2S3 + 9O2 = 2As2O3 + SO22As2S3 + 9O2 = 2As2O3 + 6SO2
Al+O2=Al2O34Al + 3O2 = 2Al2O3
Al+2 HCl=AlCl3+H22Al + 6HCl = 2AlCl3 + 3H2
Al + (CrO4) = Al2(CrO4)32Al + 3(CrO4) = Al2(CrO4)3
Al + (CrO4) = Al2(CrO4)32Al + 3(CrO4) = Al2(CrO4)3
AlCl3(aq) + Ba(OH)2(aq) = Al(OH)3(s) + BaCl2(aq)2AlCl3(aq) + 3Ba(OH)2(aq) = 2Al(OH)3(s) + 3BaCl2(aq)
AlCl3 + Ba(OH)2 =Al(OH)3 + BaCl22AlCl3 + 3Ba(OH)2 = 2Al(OH)3 + 3BaCl2
Al(NO3)3 = Al2O3 + NO2 + O24Al(NO3)3 = 2Al2O3 + 12NO2 + 3O2
AL+AgNO3=ALNO3+AgAL + AgNO3 = ALNO3 + Ag
Al2(SO4)3 + NaOH = Al(OH)3 + Na2SO4Al2(SO4)3 + 6NaOH = 2Al(OH)3 + 3Na2SO4
Ag+ +Pb = Ag+Pb2+Ag+ + 2Pb = Ag + Pb2+
Ag++Pb=Ag+Pb20Ag+ + 2Pb = 0Ag + Pb2
AgMnO4 + BaCl = AgCl + BaMnO4AgMnO4 + BaCl = AgCl + BaMnO4
Al2(SO4)3 + Ca(OH)2=Al(OH)3 + CaSO4Al2(SO4)3 + 3Ca(OH)2 = 2Al(OH)3 + 3CaSO4
Al2(SO4)3 + Ca(OH)2=Al(OH)3 + CaSO4Al2(SO4)3 + 3Ca(OH)2 = 2Al(OH)3 + 3CaSO4
Au2O3=Au+O22Au2O3 = 4Au + 3O2
As2S3+9O2=2As2O3+SO22As2S3 + 9O2 = 2As2O3 + 6SO2
AlCl3+NaOH=Al(OH)3+NaClAlCl3 + 3NaOH = Al(OH)3 + 3NaCl
AgNO3+Ga=Ag+Ga(NO3)33AgNO3 + Ga = 3Ag + Ga(NO3)3
Al2(SO4)3 + BaCl2 = BaSO4+ AlCl3Al2(SO4)3 + 3BaCl2 = 3BaSO4 + 2AlCl3
AlN+H2O=NH3+Al(OH)3AlN + 3H2O = NH3 + Al(OH)3
AlCl3(aq) + Ba(OH)2(aq) = Al(OH)3(s) + BaCl2(aq)2AlCl3(aq) + 3Ba(OH)2(aq) = 2Al(OH)3(s) + 3BaCl2(aq)
Al(ClO3)3 + SrCO3 = Al2(CO3)3 + Sr(ClO3)22Al(ClO3)3 + 3SrCO3 = Al2(CO3)3 + 3Sr(ClO3)2
Al+HCl=AlCl3+H22Al + 6HCl = 2AlCl3 + 3H2
AgNO3(aq) + Pb(s) = Pb(NO3)2(aq) +Ag(s)2AgNO3(aq) + Pb(s) = Pb(NO3)2(aq) + 2Ag(s)
AgNO3+Ga=Ag+Ga(NO3)33AgNO3 + Ga = 3Ag + Ga(NO3)3
AgF+CaCl2=AgCl+CaF22AgF + CaCl2 = 2AgCl + CaF2
Al(NO3)3+(NH4)3PO4=AlPO4+NH4NO3Al(NO3)3 + (NH4)3PO4 = AlPO4 + 3NH4NO3
Al + HCl = AlCl3 + H22Al + 6HCl = 2AlCl3 + 3H2
Au+HCl+H2O2=HAuCl2 + H2O2Au + 4HCl + H2O2 = 2HAuCl2 + 2H2O
Au+HCl+H2O2=AuCl3 + H2O2Au + 6HCl + 3H2O2 = 2AuCl3 + 6H2O
Au+HCl+H2O2=AuCl + H2O2Au + 2HCl + H2O2 = 2AuCl + 2H2O
Al+H3PO4=AlPO4+H22Al + 2H3PO4 = 2AlPO4 + 3H2
Al2O3=Al+O22Al2O3 = 4Al + 3O2
Ag+H2S= Ag2S+H22Ag + H2S = Ag2S + H2
Al2O3 + HCl = AlCl3 + H2OAl2O3 + 6HCl = 2AlCl3 + 3H2O
Al2O3 + HCl = AlCl3 + H2OAl2O3 + 6HCl = 2AlCl3 + 3H2O
AlCl3(aq) + Ba(OH)2(aq) = Al(OH)3(s) + BaCl2(aq)2AlCl3(aq) + 3Ba(OH)2(aq) = 2Al(OH)3(s) + 3BaCl2(aq)
Al+O2=AlO2Al + O2 = 2AlO
Al+O2=AlO2Al + O2 = 2AlO
Al + NH4ClO4 = Al2O3 + AlCl3 + NO + H2O3Al + 3NH4ClO4 = Al2O3 + AlCl3 + 3NO + 6H2O
AlCl3+ Ba(OH)2 = Al(OH)3+ BaCl22AlCl3 + 3Ba(OH)2 = 2Al(OH)3 + 3BaCl2
Al+Cl2=AlCl32Al + 3Cl2 = 2AlCl3
Al+Cl2=AlCl2Al + Cl2 = AlCl2
Au2O3=Au+O22Au2O3 = 4Au + 3O2
Al(s)+HCl(aq)=AlCl3(aq)+H2(g)2Al(s) + 6HCl(aq) = 2AlCl3(aq) + 3H2(g)
Al(OH)3+H2CO3=Al2(CO3)3+H2O2Al(OH)3 + 3H2CO3 = Al2(CO3)3 + 6H2O
AlCl3(aq) + H2SO4(aq) = Al2(SO4)3 + HCl 2AlCl3(aq) + 3H2SO4(aq) = Al2(SO4)3 + 6HCl
Al + H2SO4 =Al2(SO4)3 + H22Al + 3H2SO4 = Al2(SO4)3 + 3H2
Al + Ti+4 = Al+3 + Ti+22Al + 3Ti+4 = 2Al+3 + 3Ti+2
Al2(CO3)3 + NaOH = 3Na2CO3 + 2Al(OH)3Al2(CO3)3 + 6NaOH = 3Na2CO3 + 2Al(OH)3
Al+NaOH=Al(OH)3+NaAl + 3NaOH = Al(OH)3 + 3Na
AlCl3(aq) + Ba(OH)2(aq) = Al(OH)3(s) + BaCl2(aq)2AlCl3(aq) + 3Ba(OH)2(aq) = 2Al(OH)3(s) + 3BaCl2(aq)
AlCl3(aq) + Ba(OH)2(aq) = Al(OH)3(s) + BaCl2(aq)2AlCl3(aq) + 3Ba(OH)2(aq) = 2Al(OH)3(s) + 3BaCl2(aq)
AlCl3 + H2O = H3AlO3 + HAlCl44AlCl3 + 3H2O = H3AlO3 + 3HAlCl4
As2S3 + 9O2 = 2As2O3 + SO22As2S3 + 9O2 = 2As2O3 + 6SO2
As2S3 + 9O2 = 2As2O3 + SO22As2S3 + 9O2 = 2As2O3 + 6SO2
AlBr3 + LiOH = Al(OH)3 +LiBr AlBr3 + 3LiOH = Al(OH)3 + 3LiBr
AlBr3 + LiOH = H2O + Al(OH)3 +LiBr AlBr3 + 3LiOH = 0H2O + Al(OH)3 + 3LiBr
AlBr3 + LiOH = H2O + Al(OH)3 +LiBr AlBr3 + 3LiOH = 0H2O + Al(OH)3 + 3LiBr
AlBr3 + LiOH = H2O + Al(OH)3 +LiBr AlBr3 + 3LiOH = 0H2O + Al(OH)3 + 3LiBr
AlBr3 + LiOH = H2O + Al(OH)3 +LiBr AlBr3 + 3LiOH = 0H2O + Al(OH)3 + 3LiBr
AlBr3 + LiOH = H2O + Al(OH)3 +LiBr AlBr3 + 3LiOH = 0H2O + Al(OH)3 + 3LiBr
AlBr3 + LiOH = H2O + Al(OH)3 +LiBr AlBr3 + 3LiOH = 0H2O + Al(OH)3 + 3LiBr
AlBr3 + LiOH = H2O + Al(OH)3 +LiBr AlBr3 + 3LiOH = 0H2O + Al(OH)3 + 3LiBr
AlBr3 + LiOH = H2O + Al(OH)3 +LiBr AlBr3 + 3LiOH = 0H2O + Al(OH)3 + 3LiBr
AlBr3 + LiOH = H2O + Al(OH)3 +LiBr AlBr3 + 3LiOH = 0H2O + Al(OH)3 + 3LiBr
AlBr3 + LiOH = H2O + Al(OH)3 +LiBr AlBr3 + 3LiOH = 0H2O + Al(OH)3 + 3LiBr
Ag + HNO3 = NO + H2O + Ag NO33Ag + 4HNO3 = NO + 2H2O + 3AgNO3
Al + ZnCl2 = Zn + AlCl32Al + 3ZnCl2 = 3Zn + 2AlCl3
Ag2S + HNO3 = AgNO3 + S8 + NO + H2O24Ag2S + 64HNO3 = 48AgNO3 + 3S8 + 16NO + 32H2O
AlCl3(aq) + Ba(OH)2(aq) = Al(OH)3(s) + BaCl2(aq)2AlCl3(aq) + 3Ba(OH)2(aq) = 2Al(OH)3(s) + 3BaCl2(aq)
AgF+CaCl2=AgCl+CaF22AgF + CaCl2 = 2AgCl + CaF2
Al2S3+6H2O=Al(OH)3+H2SAl2S3 + 6H2O = 2Al(OH)3 + 3H2S
Al(OH)3=Al2O3 + H2O2Al(OH)3 = Al2O3 + 3H2O
Al(OH)3=Al2O3 + H2O2Al(OH)3 = Al2O3 + 3H2O
As2S5+HNO3=H3AsO4+NO2+H2O+H2SO4As2S5 + 40HNO3 = 2H3AsO4 + 40NO2 + 12H2O + 5H2SO4
As2S3+9O2=2As2O3+SO22As2S3 + 9O2 = 2As2O3 + 6SO2
As2S3+9O2=2As2O3+SO22As2S3 + 9O2 = 2As2O3 + 6SO2
As2S3+9O2=2As2O3+SO22As2S3 + 9O2 = 2As2O3 + 6SO2
As2S3+9O2=2As2O3+SO22As2S3 + 9O2 = 2As2O3 + 6SO2
Al(s)+Fe2O3(s)=Al2O3+Fe(s)2Al(s) + Fe2O3(s) = Al2O3 + 2Fe(s)
As2S3 + 9O2=2As2O3 +SO22As2S3 + 9O2 = 2As2O3 + 6SO2
Al +H2SO4 =Al2(SO4)3 + H22Al + 3H2SO4 = Al2(SO4)3 + 3H2
Al4C3+H2O=Al(OH)3+CH4Al4C3 + 12H2O = 4Al(OH)3 + 3CH4
Al2(SO4)3+NaOH=Na2SO4+NaAlO2+H2OAl2(SO4)3 + 8NaOH = 3Na2SO4 + 2NaAlO2 + 4H2O
Ag+HCl=AgCl+H22Ag + 2HCl = 2AgCl + H2
As+HNO3=NO2+H3AsO4+H2020As + 80HNO3 = 80NO2 + 20H3AsO4 + H20
As+HNO3=NO2+H3AsO4+H2020As + 80HNO3 = 80NO2 + 20H3AsO4 + H20
Al+HCl=AlCl3+H22Al + 6HCl = 2AlCl3 + 3H2
AlP+H2O+CH3(CH2)11(OCH2CH2)NOSO3NA=Al+PHO+CH3+NO3+SNA17AlP + 15H2O + CH3(CH2)11(OCH2CH2)NOSO3NA = 17Al + 17PHO + 14CH3 + NO3 + SNA
Al + NH4ClO4 = Al2O3 + AlCl3 + NO + H2O3Al + 3NH4ClO4 = Al2O3 + AlCl3 + 3NO + 6H2O
As+NaOH=Na3AsO3+H22As + 6NaOH = 2Na3AsO3 + 3H2
Al2(SO4)3+Ca(OH)2=CaSO4+Al(OH)3Al2(SO4)3 + 3Ca(OH)2 = 3CaSO4 + 2Al(OH)3
AgNO3+FeCl3=Fe(NO3)3+AgCl3AgNO3 + FeCl3 = Fe(NO3)3 + 3AgCl
AlCl3+AgNO3=AgCl+Al(NO3)3AlCl3 + 3AgNO3 = 3AgCl + Al(NO3)3
Al+CuCl2=AlCl3+Cu2Al + 3CuCl2 = 2AlCl3 + 3Cu
Al2(SO4)2+NaOH=Al(OH)3+Na2+SO4Al2(SO4)2 + 6NaOH = 2Al(OH)3 + 3Na2 + 2SO4
Al2(SO4)2+NaOH=Al(OH)3+Na2+SO4Al2(SO4)2 + 6NaOH = 2Al(OH)3 + 3Na2 + 2SO4
Al2S3+H2O=2Al(OH)3+3H2SAl2S3 + 6H2O = 2Al(OH)3 + 3H2S
Al2(SO4)3 (aq) + KOH (aq) =Al(OH)3 (s) + K2SO4 Al2(SO4)3(aq) + 6KOH(aq) = 2Al(OH)3(s) + 3K2SO4
Al + H2SO4 = Al2(SO4)3 + H22Al + 3H2SO4 = Al2(SO4)3 + 3H2
AsS3 + HClO4 + H2O = H3AsO4 + HCl + H2SO48AsS3 + 23HClO4 + 36H2O = 8H3AsO4 + 23HCl + 24H2SO4
AgNO3 + AlCl3 = AgCl + Al(NO3)33AgNO3 + AlCl3 = 3AgCl + Al(NO3)3
AgNO3 + AlCl3 = AgCl + Al(NO3)33AgNO3 + AlCl3 = 3AgCl + Al(NO3)3
Al + H2SO4 = Al2(SO4)3 + H22Al + 3H2SO4 = Al2(SO4)3 + 3H2
AlCl3(aq) + Ba(OH)2(aq) = Al(OH)3(s) + BaCl2(aq)2AlCl3(aq) + 3Ba(OH)2(aq) = 2Al(OH)3(s) + 3BaCl2(aq)
AgNo3 + AlCl3 =AgCl + Al(No3)33AgNo3 + AlCl3 = 3AgCl + Al(No3)3
As2O3 + 3H2 = 2As + 3H2OAs2O3 + 3H2 = 2As + 3H2O
As2S5 +HNO3 = H3AsO4 + NO2 + H2O + SO2As2S5 + 30HNO3 = 2H3AsO4 + 30NO2 + 12H2O + 5SO2
Al+O2=Al2O34Al + 3O2 = 2Al2O3
Al2O3 = Al (s) + O2 (g) 2Al2O3 = 4Al(s) + 3O2(g)
Al + O2 = Al2O34Al + 3O2 = 2Al2O3
AgNO3 (aq) + Cu (s) = Ag (s) + Cu(NO3)2 (aq)2AgNO3(aq) + Cu(s) = 2Ag(s) + Cu(NO3)2(aq)
Al (s)+NaOH (aq)=Al (OH) 3 (s)+Na (aq)Al(s) + 3NaOH(aq) = Al(OH)3(s) + 3Na(aq)
Ag2O=Ag+O22Ag2O = 4Ag + O2
Al2O3 = Al +O22Al2O3 = 4Al + 3O2
Ag2CO3 = Ag2O + CO2Ag2CO3 = Ag2O + CO2
Al + CuSO4 = Al2(SO4)3 + Cu2Al + 3CuSO4 = Al2(SO4)3 + 3Cu
Al2O3 + Fe = Al + Fe2O3Al2O3 + 2Fe = 2Al + Fe2O3
Al + H2SO4 = Al2(SO4)3 +H2O + SO22Al + 6H2SO4 = Al2(SO4)3 + 6H2O + 3SO2
Al (OH)3 =Al2O3+H2O2Al(OH)3 = Al2O3 + 3H2O
Al (OH)3 =Al2O3+H2O2Al(OH)3 = Al2O3 + 3H2O
Ag+HCl =AgCl+H22Ag + 2HCl = 2AgCl + H2
Ag+HCl =AgCl+HAg + HCl = AgCl + H
AlCl3 + Na2(SO4) = NaCl + Al2(SO4)32AlCl3 + 3Na2(SO4) = 6NaCl + Al2(SO4)3
Ag2SO4 + NaCl=AgCl + Na2SO4Ag2SO4 + 2NaCl = 2AgCl + Na2SO4
Al + H2SO4 = Al2(SO4)3 + H22Al + 3H2SO4 = Al2(SO4)3 + 3H2
Al+HCl=H2+AlCl32Al + 6HCl = 3H2 + 2AlCl3
AlBr3+K2SO4=KBr+Al2(SO4)32AlBr3 + 3K2SO4 = 6KBr + Al2(SO4)3
Al(s) + N2 = AlN(s)2Al(s) + N2 = 2AlN(s)
AgNO3+Cu=Cu(NO3)2+Ag2AgNO3 + Cu = Cu(NO3)2 + 2Ag
Al(OH)3 + H2CO3=Al2(CO3)3 + H2O2Al(OH)3 + 3H2CO3 = Al2(CO3)3 + 6H2O
Al(OH)3+H2SO4=Al2(SO4)3+H2O2Al(OH)3 + 3H2SO4 = Al2(SO4)3 + 6H2O
AgNO3+K2SO4=Ag2SO4+KNO32AgNO3 + K2SO4 = Ag2SO4 + 2KNO3
AlCl3(aq) + Ba(OH)2(aq) = Al(OH)3(s) + BaCl2(aq)2AlCl3(aq) + 3Ba(OH)2(aq) = 2Al(OH)3(s) + 3BaCl2(aq)
Al + CuSo4 = Al2(So4)3 + Cu2Al + 3CuSo4 = Al2(So4)3 + 3Cu
Al + NaOH + H2O = NaAlO2 + H22Al + 2NaOH + 2H2O = 2NaAlO2 + 3H2
Al+2HCl=AlCl2+H2Al + 2HCl = AlCl2 + H2
AgNO3+AlCl3=Al(NO3)3+AgCl3AgNO3 + AlCl3 = Al(NO3)3 + 3AgCl
AlCl3(s)+Ca3N2(s)=AlN(s)+CaCl2(s)2AlCl3(s) + Ca3N2(s) = 2AlN(s) + 3CaCl2(s)
Al+N2=AlN2Al + N2 = 2AlN
Al+ZnO = Al2O3 + Zn 2Al + 3ZnO = Al2O3 + 3Zn
Al2O3+ H2SO4= Al2(SO4)3+ H2OAl2O3 + 3H2SO4 = Al2(SO4)3 + 3H2O
AgSO4+AsH3+H2O=Ag+As2O3+H2SO46AgSO4 + 2AsH3 + 3H2O = 6Ag + As2O3 + 6H2SO4
AgNO3 + AlCl3=AgCl + Al(NO3)33AgNO3 + AlCl3 = 3AgCl + Al(NO3)3
AgSO4+AsH3+H2O+=Ag+As203+H2SO4609AgSO4 + 406AsH3 + 0H2O+ = 609Ag + 2As203 + 609H2SO4
AlCl3(aq) + Ba(OH)2(aq) = Al(OH)3(s) + BaCl2(aq)2AlCl3(aq) + 3Ba(OH)2(aq) = 2Al(OH)3(s) + 3BaCl2(aq)
AgNO3 + CuCl2 = AgCl + Cu(NO3)22AgNO3 + CuCl2 = 2AgCl + Cu(NO3)2
Al + CuSO4 = Al2(SO4)3 + Cu2Al + 3CuSO4 = Al2(SO4)3 + 3Cu
Al + Cr2O3=AlO3 +CrAl + Cr2O3 = AlO3 + 2Cr
Al+O2=Al2O34Al + 3O2 = 2Al2O3
Ag2O=Ag+O22Ag2O = 4Ag + O2
Al+Pb(NO3)2 = Pb + Al(NO3)2Al + Pb(NO3)2 = Pb + Al(NO3)2
Ag(NH3)2Cl + KI = AgI + KCl + NH3Ag(NH3)2Cl + KI = AgI + KCl + 2NH3
Ag(NH3)Cl + KI = AgI + KCl + NH3Ag(NH3)Cl + KI = AgI + KCl + NH3
Ag(NH3)2Cl + KI = AgI + KCl + NH3Ag(NH3)2Cl + KI = AgI + KCl + 2NH3
Ag(NO3)+AlCl3=AgCl+Al(NO3)33Ag(NO3) + AlCl3 = 3AgCl + Al(NO3)3
AgClNH3 + KI = AgI + KCl + NH3AgClNH3 + KI = AgI + KCl + NH3
AgClNH3 + KI = AgI + KCl + NH3AgClNH3 + KI = AgI + KCl + NH3
Al + HNO3 = AlNO3 + HAl + HNO3 = AlNO3 + H
Al + HNO3 = AlNO3 + HAl + HNO3 = AlNO3 + H
Al + HCl= AlCl3 + H22Al + 6HCl = 2AlCl3 + 3H2
AgNO3(aq)+CaCl2(aq)=AgCl(s)+Ca(NO3)2(aq)2AgNO3(aq) + CaCl2(aq) = 2AgCl(s) + Ca(NO3)2(aq)
AgNO3 + H2S =Ag2S + 2HNO32AgNO3 + H2S = Ag2S + 2HNO3
Al+N2=2AlN2Al + N2 = 2AlN
AgNO3(aq)+Cu=Ag+Cu(NO3)2(aq)2AgNO3(aq) + Cu = 2Ag + Cu(NO3)2(aq)
Al+N2=2AlN2Al + N2 = 2AlN
AgNO3 + H2S =Ag2S + 2HNO32AgNO3 + H2S = Ag2S + 2HNO3
AgNO3 + MgCl2 = AgCl + Mg(NO3)22AgNO3 + MgCl2 = 2AgCl + Mg(NO3)2
AlCl3(aq) + Ba(OH)2(aq) = Al(OH)3(s) + BaCl2(aq)2AlCl3(aq) + 3Ba(OH)2(aq) = 2Al(OH)3(s) + 3BaCl2(aq)
Al(OH)3=Al2O3+H2O2Al(OH)3 = Al2O3 + 3H2O
Al+HCl=AlCl3+H22Al + 6HCl = 2AlCl3 + 3H2
AlCl+H2O=Al(OH)3+H2+Cl22AlCl + 6H2O = 2Al(OH)3 + 3H2 + Cl2
Al+H2O=Al(OH)3+H22Al + 6H2O = 2Al(OH)3 + 3H2
Al+HCl=AlCl+HAl + HCl = AlCl + H
Al + H2O + NaCl = AlCl + NaOH + HAl + H2O + NaCl = AlCl + NaOH + H
Al+O2=Al2O34Al + 3O2 = 2Al2O3
AlBr3=Al+3BrAlBr3 = Al + 3Br
AlBr3=Al+3BrAlBr3 = Al + 3Br
Al(OH)3+NaOH=NaAlO2+H2OAl(OH)3 + NaOH = NaAlO2 + 2H2O
Al + Pb(NO3)2 = Al(NO3)2 + PbAl + Pb(NO3)2 = Al(NO3)2 + Pb
AgNO3 + KCl = AgCl + KNO3AgNO3 + KCl = AgCl + KNO3
Al2(SO4)3 + Ca(OH)2 = Al(OH)3 + CaSO4Al2(SO4)3 + 3Ca(OH)2 = 2Al(OH)3 + 3CaSO4
AgNO3 + K3PO4 = Ag3PO4 + KNO33AgNO3 + K3PO4 = Ag3PO4 + 3KNO3
Al2O3 + H2SO4 = Al2(SO4)3 + H2OAl2O3 + 3H2SO4 = Al2(SO4)3 + 3H2O
Al + Ag2S = Al2S3 + Ag2Al + 3Ag2S = Al2S3 + 6Ag
Ag + HNO3 = NO + H2O + Ag NO33Ag + 4HNO3 = NO + 2H2O + 3AgNO3
AlCl3(aq) + Ba(OH)2(aq) = Al(OH)3(s) + BaCl2(aq)2AlCl3(aq) + 3Ba(OH)2(aq) = 2Al(OH)3(s) + 3BaCl2(aq)
As2S3 + 9O2 =2As2O3 + SO22As2S3 + 9O2 = 2As2O3 + 6SO2
AlOH+HCl=AlCl+HOHAlOH + HCl = AlCl + HOH
AlSO3+NaOH=NaSO3+AlOHAlSO3 + NaOH = NaSO3 + AlOH
Al + Cr2O3 = Al2O3 + Cr2Al + Cr2O3 = Al2O3 + 2Cr
AlCl3(aq) + Ba(OH)2(aq) = Al(OH)3(s) + BaCl2(aq)2AlCl3(aq) + 3Ba(OH)2(aq) = 2Al(OH)3(s) + 3BaCl2(aq)
Al + H2SO4 = Al2(SO4)3 + H22Al + 3H2SO4 = Al2(SO4)3 + 3H2
AlCl3 + Ba(OH)2 = Al(OH)3 + BaCl22AlCl3 + 3Ba(OH)2 = 2Al(OH)3 + 3BaCl2
Al+H2O=AlO+H2Al + H2O = AlO + H2
Al+H2O=AlO+HAl + H2O = AlO + 2H
Al(OH)3 + NaNO3 = Al(NO3)3 + NaOHAl(OH)3 + 3NaNO3 = Al(NO3)3 + 3NaOH
Al(NO3)3 + Na2S = Al2S3 +NaNO32Al(NO3)3 + 3Na2S = Al2S3 + 6NaNO3
Al(NO3)3 + Na2S = Al2S3 +NaNO32Al(NO3)3 + 3Na2S = Al2S3 + 6NaNO3
AlCl3(aq) + Ba(OH)2(aq) = Al(OH)3(s) + BaCl2(aq)2AlCl3(aq) + 3Ba(OH)2(aq) = 2Al(OH)3(s) + 3BaCl2(aq)
AlCl3(aq) + Ba(OH)2(aq) = Al(OH)3(s) + BaCl2(aq)2AlCl3(aq) + 3Ba(OH)2(aq) = 2Al(OH)3(s) + 3BaCl2(aq)
Al(OH)3 + HBr = H2O + Al(Br)3Al(OH)3 + 3HBr = 3H2O + Al(Br)3
As2S3 + 9O2 = 2As2O3 + SO2 2As2S3 + 9O2 = 2As2O3 + 6SO2
Al + CuO = Al2O3 + Cu 2Al + 3CuO = Al2O3 + 3Cu
AlCl3(aq) + Ba(OH)2(aq) = Al(OH)3(s) + BaCl2(aq)2AlCl3(aq) + 3Ba(OH)2(aq) = 2Al(OH)3(s) + 3BaCl2(aq)
Al2O3 = Al+O22Al2O3 = 4Al + 3O2
Ag2O=Ag+O22Ag2O = 4Ag + O2

This program was created with a lot of help from:

Biology Flashcards

FDA Drug Database

A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 

Problems, Comments, Suggestions? Click here to contact Greg Thatcher

Please read my Disclaimer

Copyright (c) 2013 Thatcher Development Software, LLC. All rights reserved. No claim to original U.S. Gov't works.